AGR structure
|
Common Name | AGR | ||
|---|---|---|---|---|
| CAS Number | 945245-90-9 | Molecular Weight | 986.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H63N15O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AGRAGR is a peptide. AGR recognizes lymphatic vessels in fully developed prostate tumors but not in the pre-malignant lesions[1]. |
| Name | AGR |
|---|
| Description | AGR is a peptide. AGR recognizes lymphatic vessels in fully developed prostate tumors but not in the pre-malignant lesions[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C38H63N15O12S2 |
|---|---|
| Molecular Weight | 986.13 |
| InChIKey | MFOQZVBTICLRRI-KWOAWZLCSA-N |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(C)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CS)C(=O)O |