Glycine,N,N-bis(phenylsulfonyl)-, ethyl ester
Modify Date: 2025-09-19 01:38:33
Glycine,N,N-bis(phenylsulfonyl)-, ethyl ester structure
|
Common Name | Glycine,N,N-bis(phenylsulfonyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 94500-78-4 | Molecular Weight | 383.43900 | |
| Density | 1.381g/cm3 | Boiling Point | 542.6ºC at 760mmHg | |
| Molecular Formula | C16H17NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.9ºC | |
| Name | ethyl 2-[bis(benzenesulfonyl)amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 542.6ºC at 760mmHg |
| Molecular Formula | C16H17NO6S2 |
| Molecular Weight | 383.43900 |
| Flash Point | 281.9ºC |
| Exact Mass | 383.05000 |
| PSA | 114.58000 |
| LogP | 3.79090 |
| Index of Refraction | 1.587 |
| InChIKey | JPYKCMNCESLVOL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
Glycine,N,N-bis... CAS#:94500-78-4 |
| Literature: Pettit,G.R.; Kadunce,R.E. Journal of Organic Chemistry, 1962 , vol. 27, p. 4566 - 4570 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N,N-Dibenzolsulfonyl-glycin-aethylester |