Rhuscholide A structure
|
Common Name | Rhuscholide A | ||
|---|---|---|---|---|
| CAS Number | 944804-58-4 | Molecular Weight | 462.66 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 604.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C31H42O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.0±24.3 °C | |
Use of Rhuscholide ARhuscholide A is a benzofuran lactone that shows significant anti-HIV-1 activity, with an EC50 of 1.62 μM[1]. |
| Name | Rhuscholide A |
|---|---|
| Synonym | More Synonyms |
| Description | Rhuscholide A is a benzofuran lactone that shows significant anti-HIV-1 activity, with an EC50 of 1.62 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 604.7±55.0 °C at 760 mmHg |
| Molecular Formula | C31H42O3 |
| Molecular Weight | 462.66 |
| Flash Point | 227.0±24.3 °C |
| Exact Mass | 462.313385 |
| PSA | 46.53000 |
| LogP | 10.70 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | LPJLAXYRFCLYIG-HBKYZHKXSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCc1cc(O)cc2c1OC(=O)C2=C(C)C |
| 5-Hydroxy-3-isopropylidene-7-[(2E,6E,10E)-3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraen-1-yl]-1-benzofuran-2(3H)-one |
| 2(3H)-Benzofuranone, 5-hydroxy-3-(1-methylethylidene)-7-[(2E,6E,10E)-3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraen-1-yl]- |