bis(furan-2-ylmethyl) butanedioate
Modify Date: 2024-04-03 18:11:46
bis(furan-2-ylmethyl) butanedioate structure
|
Common Name | bis(furan-2-ylmethyl) butanedioate | ||
|---|---|---|---|---|
| CAS Number | 94245-64-4 | Molecular Weight | 278.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(furan-2-ylmethyl) butanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O6 |
|---|---|
| Molecular Weight | 278.25700 |
| Exact Mass | 278.07900 |
| PSA | 78.88000 |
| LogP | 2.43940 |
| InChIKey | ZNWKADAWGHKFPV-UHFFFAOYSA-N |
| SMILES | O=C(CCC(=O)OCc1ccco1)OCc1ccco1 |
|
~%
bis(furan-2-ylm... CAS#:94245-64-4 |
| Literature: Edwards; Mitchell Journal of the American Chemical Society, 1954 , vol. 76, p. 5150 |
| Butanedioic acid,bis(2-furanylmethyl) ester |
| succinic acid difurfuryl ester |
| Bernsteinsaeure-difurfurylester |