N1,N2-bis(furan-2-ylmethyl)oxalamide structure
|
Common Name | N1,N2-bis(furan-2-ylmethyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 69010-90-8 | Molecular Weight | 248.23500 | |
| Density | 1.283g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis(furan-2-ylmethyl)oxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.23500 |
| Exact Mass | 248.08000 |
| PSA | 84.48000 |
| LogP | 1.58700 |
| Index of Refraction | 1.547 |
| InChIKey | XRURWFXKCKASSN-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccco1)C(=O)NCc1ccco1 |
| Storage condition | -20℃ |
| HS Code | 2932190090 |
|---|
|
~%
N1,N2-bis(furan... CAS#:69010-90-8 |
| Literature: Kitagawa, Tokujiro; Tsutsui, Chinatsu; Hayashi, Kumi; Yamano, Aiko Chemical and Pharmaceutical Bulletin, 1998 , vol. 46, # 3 p. 514 - 517 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N,N'-difurfuryl-oxalamide |
| N,N'-Bis-furan-2-ylmethyl-oxalamide |