1h,1h,2h,3h,3h-perfluoroundecan-1,2-diol
Modify Date: 2025-09-10 03:34:42
1h,1h,2h,3h,3h-perfluoroundecan-1,2-diol structure
|
Common Name | 1h,1h,2h,3h,3h-perfluoroundecan-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 94159-84-9 | Molecular Weight | 494.14500 | |
| Density | 1.655 g/cm3 | Boiling Point | 241.9ºC at 760 mmHg | |
| Molecular Formula | C11H7F17O2 | Melting Point | 114ºC | |
| MSDS | N/A | Flash Point | 100.1ºC | |
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.655 g/cm3 |
|---|---|
| Boiling Point | 241.9ºC at 760 mmHg |
| Melting Point | 114ºC |
| Molecular Formula | C11H7F17O2 |
| Molecular Weight | 494.14500 |
| Flash Point | 100.1ºC |
| Exact Mass | 494.01700 |
| PSA | 40.46000 |
| LogP | 4.73910 |
| Index of Refraction | 1.316 |
| InChIKey | CGRIOEGIXRPCJU-UHFFFAOYSA-N |
| SMILES | OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S24/25 |
| HS Code | 2905590090 |
|
~89%
1h,1h,2h,3h,3h-... CAS#:94159-84-9 |
| Literature: Daikin Industries, Ltd. Patent: EP1548001 A1, 2005 ; Location in patent: Page/Page column 7-8 ; |
|
~98%
1h,1h,2h,3h,3h-... CAS#:94159-84-9 |
| Literature: Cirkva, Vladimir; Ameduri, Bruno; Boutevin, Bernard; Paleta, Oldrich Journal of Fluorine Chemistry, 1997 , vol. 84, # 1 p. 53 - 61 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1H,1H,2H,3H,3H-Perfluoro-1,2,-undecanediol |
| 1H,1H,2H,3H,3H-Perfluoroundecan-1,2-diol |
| MFCD00044096 |
| 1h,1h,2h,3h,3h-perfluoroundecane-1,2-diol |
| EINECS 303-265-3 |
| PC6220U |