(+)-LONGIFOLENE
Modify Date: 2025-08-25 12:03:22
(+)-LONGIFOLENE structure
|
Common Name | (+)-LONGIFOLENE | ||
|---|---|---|---|---|
| CAS Number | 94133-41-2 | Molecular Weight | 214.30100 | |
| Density | 1.01g/cm3 | Boiling Point | 293.5ºC at 760mmHg | |
| Molecular Formula | C12H22O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 122.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 293.5ºC at 760mmHg |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30100 |
| Flash Point | 122.5ºC |
| Exact Mass | 214.15700 |
| PSA | 46.53000 |
| LogP | 2.54840 |
| Index of Refraction | n20/D 1.465(lit.) |
| InChIKey | CILPHQCEVYJUDN-AXFHLTTASA-N |
| SMILES | CC1CCC(C(C)C)C(OCC(=O)O)C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918990090 |
|
~%
(+)-LONGIFOLENE CAS#:94133-41-2 |
| Literature: Journal of the Society of Chemical Industry, London, , vol. 51, p. 329 T, 331 T, 332 T |
|
~%
(+)-LONGIFOLENE CAS#:94133-41-2 |
| Literature: Journal of the Society of Chemical Industry, London, , vol. 51, p. 329 T, 331 T, 332 T |
|
~%
(+)-LONGIFOLENE CAS#:94133-41-2 |
| Literature: Journal of the Society of Chemical Industry, London, , vol. 51, p. 329 T, 331 T, 332 T |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ()-Menthoxyacetic Acid |
| EINECS 302-700-4 |
| L-(Menthyloxy)acetic acid |
| O-((1S)-Menthyl)-glykolsaeure |
| O-((1S)-menthyl)-glycolic acid |
| ((1S)-Menthyloxy)-essigsaeure |
| (+)-Menthyloxyacetic acid |
| MFCD00077813 |
| (+)-menthoxyethanoic acid |