3,7-dimethylocta-2,6-dienyl methacrylate
Modify Date: 2025-11-25 11:32:39
3,7-dimethylocta-2,6-dienyl methacrylate structure
|
Common Name | 3,7-dimethylocta-2,6-dienyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 94070-95-8 | Molecular Weight | 222.32300 | |
| Density | 0.908g/cm3 | Boiling Point | 300.9ºC at 760mmHg | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.5ºC | |
| Name | 3,7-dimethylocta-2,6-dienyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.908g/cm3 |
|---|---|
| Boiling Point | 300.9ºC at 760mmHg |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32300 |
| Flash Point | 141.5ºC |
| Exact Mass | 222.16200 |
| PSA | 26.30000 |
| LogP | 3.79840 |
| Index of Refraction | 1.467 |
| InChIKey | DWJIEXRXQKFNAB-UKTHLTGXSA-N |
| SMILES | C=C(C)C(=O)OCC=C(C)CCC=C(C)C |
| HS Code | 2916140000 |
|---|
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| 3,7-Dimethylocta-2,6-dienyl methacrylate |
| Geranylmethacrylat |