3,7-dimethylocta-2,6-dienyl 5,9,13-trimethyltetradeca-4,8,12-enoate
Modify Date: 2025-09-26 17:01:36
3,7-dimethylocta-2,6-dienyl 5,9,13-trimethyltetradeca-4,8,12-enoate structure
|
Common Name | 3,7-dimethylocta-2,6-dienyl 5,9,13-trimethyltetradeca-4,8,12-enoate | ||
|---|---|---|---|---|
| CAS Number | 16898-88-7 | Molecular Weight | 400.63700 | |
| Density | 0.9g/cm3 | Boiling Point | 484.7ºC at 760mmHg | |
| Molecular Formula | C27H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.3ºC | |
| Name | 3,7-dimethylocta-2,6-dienyl 5,9,13-trimethyltetradeca-4,8,12-trienoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9g/cm3 |
|---|---|
| Boiling Point | 484.7ºC at 760mmHg |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.63700 |
| Flash Point | 93.3ºC |
| Exact Mass | 400.33400 |
| PSA | 26.30000 |
| LogP | 8.42170 |
| Vapour Pressure | 1.5E-09mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | ZPACYDRSPFRDHO-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(=O)OCC=C(C)CCC=C(C)C |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3,7-Dimethylocta-2,6-dienyl 5,9,13-trimethyltetradeca-4,8,12-enoate |
| 51-77-4 |
| EINECS 240-942-1 |
| 3,7-dimethylocta-2,6-dien-1-yl 5,9,13-trimethyltetradeca-4,8,12-trienoate |