2-BROMO-1-(BROMOMETHYL)-4-NITROBENZENE structure
|
Common Name | 2-BROMO-1-(BROMOMETHYL)-4-NITROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 940-05-6 | Molecular Weight | 294.92800 | |
| Density | 2.006g/cm3 | Boiling Point | 348ºC at 760mmHg | |
| Molecular Formula | C7H5Br2NO2 | Melting Point | 73-74ºC | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | 2-Bromo-1-(bromomethyl)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.006g/cm3 |
|---|---|
| Boiling Point | 348ºC at 760mmHg |
| Melting Point | 73-74ºC |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.92800 |
| Flash Point | 164.3ºC |
| Exact Mass | 292.86900 |
| PSA | 45.82000 |
| LogP | 3.77540 |
| Index of Refraction | 1.642 |
| InChIKey | IHNSPLNYBYYNKQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CBr)c(Br)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | C |
|---|---|
| RIDADR | 3261.0 |
| HS Code | 2904909090 |
|
~33%
2-BROMO-1-(BROM... CAS#:940-05-6 |
| Literature: Dainippon Sumitomo Pharma Co., Ltd. Patent: EP1844768 A1, 2007 ; Location in patent: Page/Page column 39 ; |
|
~94%
2-BROMO-1-(BROM... CAS#:940-05-6 |
| Literature: Gabriele, Bartolo; Veltri, Lucia; Maltese, Vito; Spina, Rosella; Mancuso, Raffaella; Salerno, Giuseppe European Journal of Organic Chemistry, 2011 , # 28 p. 5626 - 5635 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-4-nitrobenzyl bromide |
| bromobromomethylnitrobenzene |
| 2-bromo-5-nitrobenzyl bromide |
| 2-Brom-4-nitro-benzylbromid |