1,4,6-triethyl-1,4-dimethyl-5,7-dinitro-tetralin structure
|
Common Name | 1,4,6-triethyl-1,4-dimethyl-5,7-dinitro-tetralin | ||
|---|---|---|---|---|
| CAS Number | 93990-76-2 | Molecular Weight | 334.41000 | |
| Density | 1.097g/cm3 | Boiling Point | 399.7ºC at 760mmHg | |
| Molecular Formula | C18H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.6ºC | |
| Name | 1,4,6-triethyl-1,4-dimethyl-5,7-dinitro-2,3-dihydronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 399.7ºC at 760mmHg |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.41000 |
| Flash Point | 158.6ºC |
| Exact Mass | 334.18900 |
| PSA | 91.64000 |
| LogP | 6.24100 |
| InChIKey | HWDSSJJCRXPONG-UHFFFAOYSA-N |
| SMILES | CCc1c([N+](=O)[O-])cc2c(c1[N+](=O)[O-])C(C)(CC)CCC2(C)CC |
|
~%
1,4,6-triethyl-... CAS#:93990-76-2 |
| Literature: Wood,T.F. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 2248 - 2255 |
|
~%
1,4,6-triethyl-... CAS#:93990-76-2 |
| Literature: Wood,T.F. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 2248 - 2255 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,7-Dinitro-1,4-dimethyl-1,4,6-triethyl-tetralin |
| 1,4,6-triethyl-1,4-dimethyl-5,7-dinitro-1,2,3,4-tetrahydronaphthalene |