p,p'-DDD-d8 structure
|
Common Name | p,p'-DDD-d8 | ||
|---|---|---|---|---|
| CAS Number | 93952-20-6 | Molecular Weight | 328.09000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H2Cl4D8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of p,p'-DDD-d8p,p'-DDD-d8 is the deuterium labeled p,p'-DDD[1]. p,p'-DDD is a major metabolite of p,p'-DDT. p,p'-DDD occurs in the feces and livers of rats, that are given p,p'-DDT by stomach tube, but not of rats injected intraperitoneally with p,p'-DDT[2][3]. |
| Name | 4,4′-Dichlorobenzophenone D8 |
|---|
| Description | p,p'-DDD-d8 is the deuterium labeled p,p'-DDD[1]. p,p'-DDD is a major metabolite of p,p'-DDT. p,p'-DDD occurs in the feces and livers of rats, that are given p,p'-DDT by stomach tube, but not of rats injected intraperitoneally with p,p'-DDT[2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C14H2Cl4D8 |
|---|---|
| Molecular Weight | 328.09000 |
| Exact Mass | 326.00400 |
| LogP | 5.92900 |
| InChIKey | AHJKRLASYNVKDZ-PGRXLJNUSA-N |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)Cl)cc1 |