Hexachlorobenzene 13C6
Modify Date: 2025-08-25 18:11:42
Hexachlorobenzene 13C6 structure
|
Common Name | Hexachlorobenzene 13C6 | ||
|---|---|---|---|---|
| CAS Number | 93952-14-8 | Molecular Weight | 290.73800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6Cl6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS08, GHS09 |
Signal Word | Danger | |
| Name | Hexachlorobenzene 13C6 |
|---|
| Molecular Formula | C6Cl6 |
|---|---|
| Molecular Weight | 290.73800 |
| Exact Mass | 287.83300 |
| LogP | 5.60700 |
| InChIKey | CKAPSXZOOQJIBF-IDEBNGHGSA-N |
| SMILES | Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| Storage condition | 0-6°C |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H350-H372-H410 |
| Precautionary Statements | P201-P273-P308 + P313-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R45 |
| Safety Phrases | 53-45-60-61 |
| RIDADR | UN 2729 6.1/PG 3 |
| WGK Germany | 3 |
|
High serum organochlorine pesticide concentrations in diabetics of a cotton producing area of the Benin Republic (West Africa).
Environ. Int. 69 , 1-8, (2014) The Borgou region of northern Benin is a major cotton producing area and consistently uses higher amounts of pesticides than other areas of the country. Organochlorine pesticides (OCPs), poorly handle... |