tert-Butyl 4-amino-3-methylbenzoate structure
|
Common Name | tert-Butyl 4-amino-3-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 934481-43-3 | Molecular Weight | 207.269 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 339.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4±19.9 °C | |
| Name | tert-Butyl 4-amino-3-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.9±22.0 °C at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.269 |
| Flash Point | 187.4±19.9 °C |
| Exact Mass | 207.125931 |
| PSA | 52.32000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | HFMIRAQWPTZEAH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)OC(C)(C)C)ccc1N |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
|
~96%
tert-Butyl 4-am... CAS#:934481-43-3 |
| Literature: Roche Palo Alto LLC Patent: US2007/88015 A1, 2007 ; Location in patent: Page/Page column 20 ; |
|
~%
tert-Butyl 4-am... CAS#:934481-43-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 24, # 4 p. 1098 - 1103 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| TERT-BUTYL4-AMINO-3-METHYLBENZOATE |
| Benzoic acid, 4-amino-3-methyl-, 1,1-dimethylethyl ester |
| 4-amino-3-methyl-benzoic acid tert-butyl ester |
| QC-9993 |
| 2-Methyl-2-propanyl 4-amino-3-methylbenzoate |