Degarelix (acetate)
Modify Date: 2025-08-23 13:28:44
Degarelix (acetate) structure
|
Common Name | Degarelix (acetate) | ||
|---|---|---|---|---|
| CAS Number | 934016-19-0 | Molecular Weight | 1692.311 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C84H107ClN18O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Degarelix (acetate)Degarelix is a synthetic gonadotropin-releasing hormone receptor (GNRHR) antagonist (IC50 = 3 nM in HEK293 cells expressing the human receptor). |
| Name | EXT215F4ZU |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C84H107ClN18O18 |
|---|---|
| Molecular Weight | 1692.311 |
| Exact Mass | 1690.769897 |
| InChIKey | AUTFSFUMNFDPLH-KYMMNHPFSA-N |
| SMILES | CC(=O)NC(Cc1ccc2ccccc2c1)C(=O)NC(Cc1ccc(Cl)cc1)C(=O)NC(Cc1cccnc1)C(=O)NC(CO)C(=O)NC(Cc1ccc(NC(=O)C2CC(=O)NC(=O)N2)cc1)C(=O)NC(Cc1ccc(NC(N)=O)cc1)C(=O)NC(CC(C)C)C(=O)NC(CCCCNC(C)C)C(=O)N1CCCC1C(=O)NC(C)C(N)=O.CC(=O)O |
| (4S)-N-{4-[(2S,5S,8R,11R,14R)-2-({(2R)-1-{[(2S)-1-{[(2S)-1-[(2S)-2-{[(2R)-1-Amino-1-oxo-2-propanyl]carbamoyl}-1-pyrrolidinyl]-6-(isopropylamino)-1-oxo-2-hexanyl]amino}-4-methyl-1-oxo-2-pentanyl]amino}-3-[4-(carbamoylamino)phenyl]-1-oxo-2-propanyl}carbamoyl)-11-(4-chlorobenzyl)-5-(hydroxymethyl)-14-(2-naphthylmethyl)-4,7,10,13,16-pentaoxo-8-(3-pyridinylmethyl)-3,6,9,12,15-pentaazaheptadec-1-yl]phenyl}-2,6-dioxohexahydro-4-pyrimidinecarboxami |
| EXT215F4ZU |