PAMAM-G2
Modify Date: 2025-08-21 13:18:28
PAMAM-G2 structure
|
Common Name | PAMAM-G2 | ||
|---|---|---|---|---|
| CAS Number | 93376-66-0 | Molecular Weight | 3256.178 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 2623.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C142H288N58O28 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1540.6±34.3 °C | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | PAMAM dendrimer generation 2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 2623.7±65.0 °C at 760 mmHg |
| Molecular Formula | C142H288N58O28 |
| Molecular Weight | 3256.178 |
| Flash Point | 1540.6±34.3 °C |
| Exact Mass | 3254.289551 |
| PSA | 1276.48000 |
| LogP | -33.85 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | QYMWEDAKQRTCGD-UHFFFAOYSA-N |
| SMILES | NCCNC(=O)CCN(CCNC(=O)CCN(CCNC(=O)CCN(CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCN(CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN(CCC(=O)NCCN)CCC(=O)NCCN)CCC(=O)NCCN |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Risk Phrases | 11-23/25-36/38 |
| Safety Phrases | 7-16-24-45 |
| RIDADR | UN 1230 3/PG 2 |
|
Amine-terminated dendrimers as biomimetic templates for silica nanosphere formation.
Langmuir 20 , 4728, (2004) In diatoms, silica synthesis occurs by use of complex posttranslationally modified peptides, termed silaffins, and highly complex biological polyamine structures. Silaffin peptides have lysine residue... |
|
|
Kobayashi, H., et al.
Magn. Reson. in Med. 50 , 758, (2003)
|
| G2 PAMAM dendrimer |
| PAMAM G2.0 |
| PAMAM G2 |
| MFCD00197936 |