(1E)-N-[(Pentafluorobenzyl)oxy]-2-propen-1-imine
Modify Date: 2025-09-04 09:29:05
![(1E)-N-[(Pentafluorobenzyl)oxy]-2-propen-1-imine Structure](https://image.chemsrc.com/caspic/071/932710-55-9.png)
(1E)-N-[(Pentafluorobenzyl)oxy]-2-propen-1-imine structure
|
Common Name | (1E)-N-[(Pentafluorobenzyl)oxy]-2-propen-1-imine | ||
|---|---|---|---|---|
| CAS Number | 932710-55-9 | Molecular Weight | 251.15300 | |
| Density | 1.32g/cm3 | Boiling Point | 229.6ºC at 760 mmHg | |
| Molecular Formula | C10H6F5NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 92.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (1E)-N-[(Pentafluorobenzyl)oxy]-2-propen-1-imine |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 229.6ºC at 760 mmHg |
| Molecular Formula | C10H6F5NO |
| Molecular Weight | 251.15300 |
| Flash Point | 92.6ºC |
| Exact Mass | 251.03700 |
| PSA | 21.59000 |
| LogP | 3.07050 |
| Index of Refraction | 1.436 |
| InChIKey | ICDUEGOPUWNJNF-HQYXKAPLSA-N |
| SMILES | C=CC=NOCc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |