pfboa-propionaldehyde structure
|
Common Name | pfboa-propionaldehyde | ||
|---|---|---|---|---|
| CAS Number | 932710-53-7 | Molecular Weight | 253.16900 | |
| Density | 1.333g/cm3 | Boiling Point | 233.11ºC at 760 mmHg | |
| Molecular Formula | C10H8F5NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 94.782ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propan-1-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 233.11ºC at 760 mmHg |
| Molecular Formula | C10H8F5NO |
| Molecular Weight | 253.16900 |
| Flash Point | 94.782ºC |
| Exact Mass | 253.05300 |
| PSA | 21.59000 |
| LogP | 3.29450 |
| Index of Refraction | 1.436 |
| InChIKey | BOPZGAUHLLBMFA-HQYXKAPLSA-N |
| SMILES | CCC=NOCc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 0-6°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| Propionaldehyde,(O-pentafluorobenzyl)oxime,(Z) or (E) |
| Propionaldehyde O-pentafluorophenylmethyl-oxime |
| Propionaldehyde O-2,3,4,5,6-PFBHA-oxime |