5-(3-chlorophenyl)-5-hydroxy-1-methylpyrrolidin-2-one structure
|
Common Name | 5-(3-chlorophenyl)-5-hydroxy-1-methylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 93040-74-5 | Molecular Weight | 225.67100 | |
| Density | 1.344g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 5-(3-chlorophenyl)-5-hydroxy-1-methylpyrrolidin-2-one |
|---|
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 208.9ºC |
| Exact Mass | 225.05600 |
| PSA | 40.54000 |
| LogP | 1.67520 |
| Index of Refraction | 1.603 |
| InChIKey | DSWHUSOOSLOXMO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC1(O)c1cccc(Cl)c1 |
|
~%
5-(3-chlorophen... CAS#:93040-74-5 |
| Literature: Houlihan, William J.; Gogerty, John H.; Ryan, Eileen A.; Schmitt, Gemma Journal of Medicinal Chemistry, 1985 , vol. 28, # 1 p. 28 - 31 |