2,2-Biphenyldiacetic acid structure
|
Common Name | 2,2-Biphenyldiacetic acid | ||
|---|---|---|---|---|
| CAS Number | 93012-30-7 | Molecular Weight | 232.28000 | |
| Density | 1.121g/cm3 | Boiling Point | 468.1ºC at 760mmHg | |
| Molecular Formula | C16H12N2 | Melting Point | 78-79ºC | |
| MSDS | N/A | Flash Point | 231.7ºC | |
| Name | biphenyl-2,2'-diacetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 468.1ºC at 760mmHg |
| Melting Point | 78-79ºC |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28000 |
| Flash Point | 231.7ºC |
| Exact Mass | 232.10000 |
| PSA | 47.58000 |
| LogP | 3.48576 |
| Index of Refraction | 1.614 |
| InChIKey | IXBKIGKDLZRRAL-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccccc1-c1ccccc1CC(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2917399090 |
|
~85%
2,2-Biphenyldia... CAS#:93012-30-7 |
| Literature: Chang, Yu Mi; Lee, Seung Hwan; Cho, Min Young; Yoo, Byung Woo; Rhee, Hak June; Lee, Sang Ho; Yoon, Cheol Min Synthetic Communications, 2005 , vol. 35, # 13 p. 1851 - 1857 |
|
~%
2,2-Biphenyldia... CAS#:93012-30-7 |
| Literature: Journal of the American Chemical Society, , vol. 84, p. 1449 - 1455 |
|
~%
2,2-Biphenyldia... CAS#:93012-30-7 |
| Literature: Monatshefte fuer Chemie, , vol. 34, p. 207 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,2'-biphenyldiessigsaeure |
| MFCD00060295 |
| Biphenyl-2,2'-diyldi-essigsaeure |
| Phosphorothioic acid,O,O-dimethyl ester,O-ester with 3-chloro-4-hydroxybenzonitrile |
| biphenyl-2,2'-diyldi-acetic acid |