Ethyl 3-formyl-1H-indole-7-carboxylate structure
|
Common Name | Ethyl 3-formyl-1H-indole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 927181-98-4 | Molecular Weight | 217.22100 | |
| Density | 1.293 | Boiling Point | 411.1ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-formyl-1H-indole-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293 |
|---|---|
| Boiling Point | 411.1ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Exact Mass | 217.07400 |
| PSA | 59.16000 |
| LogP | 2.15710 |
| Index of Refraction | 1.655 |
| InChIKey | XUTDEDCNVFAAEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc2c(C=O)c[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-formylindole-7-carboxylic acid ethyl ester |