5-[3-(trifluoromethyl)phenyl]-1H-tetrazole
Modify Date: 2025-09-12 12:43:16
![5-[3-(trifluoromethyl)phenyl]-1H-tetrazole Structure](https://image.chemsrc.com/caspic/087/92712-48-6.png)
5-[3-(trifluoromethyl)phenyl]-1H-tetrazole structure
|
Common Name | 5-[3-(trifluoromethyl)phenyl]-1H-tetrazole | ||
|---|---|---|---|---|
| CAS Number | 92712-48-6 | Molecular Weight | 214.14700 | |
| Density | 1.464g/cm3 | Boiling Point | 325.2ºC at 760 mmHg | |
| Molecular Formula | C8H5F3N4 | Melting Point | 156-158°C | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | 5-[3-(trifluoromethyl)phenyl]-2H-tetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 325.2ºC at 760 mmHg |
| Melting Point | 156-158°C |
| Molecular Formula | C8H5F3N4 |
| Molecular Weight | 214.14700 |
| Flash Point | 150.5ºC |
| Exact Mass | 214.04700 |
| PSA | 54.46000 |
| LogP | 1.88550 |
| Index of Refraction | 1.521 |
| InChIKey | KWSLGOVYXMQPPX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(-c2nn[nH]n2)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933990090 |
|
~%
5-[3-(trifluoro... CAS#:92712-48-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 30, # 3 p. 552 - 562 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-[3-(trifluoromethyl)phenyl]-1H-tetrazole |
| 5-(3-Trifluoromethyl-phenyl)-2H-tetrazole |
| 5-[3-(trifluoromethyl)phenyl]-2h-1,2,3,4-tetraazole |
| 5-[3-(trifluoromethyl)phenyl]-2H-1,2,3,4-tetrazole |
| MFCD00068098 |