1-(4-tert-butylcyclohexen-1-yl)prop-2-en-1-one structure
|
Common Name | 1-(4-tert-butylcyclohexen-1-yl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 92622-56-5 | Molecular Weight | 192.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-tert-butylcyclohexen-1-yl)prop-2-en-1-one |
|---|
| Molecular Formula | C13H20O |
|---|---|
| Molecular Weight | 192.29700 |
| Exact Mass | 192.15100 |
| PSA | 17.07000 |
| LogP | 3.51410 |
| InChIKey | WMQGROVYHRYLHC-UHFFFAOYSA-N |
| SMILES | C=CC(=O)C1=CCC(C(C)(C)C)CC1 |
|
~76%
1-(4-tert-butyl... CAS#:92622-56-5 |
| Literature: Crisp,G.T.; Scott,W.J.; Stille,J.K. Journal of the American Chemical Society, 1984 , vol. 106, p. 7500 |