methyl tetraisopropylphosphorodiamidite structure
|
Common Name | methyl tetraisopropylphosphorodiamidite | ||
|---|---|---|---|---|
| CAS Number | 92611-10-4 | Molecular Weight | 278.37100 | |
| Density | 0.915 g/mL at 25 °C(lit.) | Boiling Point | 287.3ºC at 760mmHg | |
| Molecular Formula | C13H31N2O2P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 127.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[[di(propan-2-yl)amino]-methoxyphosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.915 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 287.3ºC at 760mmHg |
| Molecular Formula | C13H31N2O2P |
| Molecular Weight | 278.37100 |
| Flash Point | 127.5ºC |
| Exact Mass | 278.21200 |
| PSA | 42.59000 |
| LogP | 3.97850 |
| Index of Refraction | n20/D 1.461(lit.) |
| InChIKey | YFYBXOIQXOOUCI-UHFFFAOYSA-N |
| SMILES | COP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 14-36/37/38 |
| Safety Phrases | 7-26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2929909090 |
|
~79%
methyl tetraiso... CAS#:92611-10-4 |
| Literature: Moore, Michael F.; Beaucage, Serge L. Journal of Organic Chemistry, 1985 , vol. 50, # 12 p. 2019 - 2025 |
|
~%
methyl tetraiso... CAS#:92611-10-4 |
| Literature: Chemistry Letters, , p. 1401 - 1404 |
|
~%
methyl tetraiso... CAS#:92611-10-4 |
| Literature: Chemistry Letters, , p. 1401 - 1404 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methyl N,N,N',N'-tetraisopropylphosphorodiamidite |
| methyl tetraisopropylphosphorodiamidite |
| MFCD00192324 |
| methyl N,N,N',N'-tetraisopropylphosphordiamidite |
| methoxy N,N,N',N'-tetraisopropylphosphordiamidite |