HAEGTFT
Modify Date: 2025-08-20 18:43:37
HAEGTFT structure
|
Common Name | HAEGTFT | ||
|---|---|---|---|---|
| CAS Number | 926018-95-3 | Molecular Weight | 761.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H47N9O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HAEGTFTHAEGTFT is the first N-terminal 1-7 residues of GLP-1 peptide. |
| Name | HAEGTFT |
|---|
| Description | HAEGTFT is the first N-terminal 1-7 residues of GLP-1 peptide. |
|---|---|
| Related Catalog |
| Molecular Formula | C33H47N9O12 |
|---|---|
| Molecular Weight | 761.78 |
| InChIKey | LFSUKVJRPWYPMM-OEKZNVCNSA-N |
| SMILES | CC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)NC(C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)O)C(C)O)C(C)O |