N-(3-acetamido-2-methylphenyl)acetamide
Modify Date: 2025-09-26 17:39:49
N-(3-acetamido-2-methylphenyl)acetamide structure
|
Common Name | N-(3-acetamido-2-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 92491-20-8 | Molecular Weight | 206.24100 | |
| Density | 1.199g/cm3 | Boiling Point | 424.4ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | N-(3-acetamido-2-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760 mmHg |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24100 |
| Flash Point | 182ºC |
| Exact Mass | 206.10600 |
| PSA | 65.18000 |
| LogP | 3.21080 |
| Index of Refraction | 1.61 |
| InChIKey | NAXDRCLBFGZQSR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(NC(C)=O)c1C |
|
~%
N-(3-acetamido-... CAS#:92491-20-8 |
| Literature: Edge Journal of the Chemical Society, 1923 , vol. 123, p. 1013 |
| 2,6-Diacetylaminotoluol |
| 2,6-Bis-acetamino-toluol |
| 2-Methyl-N.N'-diacetyl-m-phenylendiamin |