Uridine-15N2
Modify Date: 2025-08-21 22:01:17
Uridine-15N2 structure
|
Common Name | Uridine-15N2 | ||
|---|---|---|---|---|
| CAS Number | 92487-68-8 | Molecular Weight | 244.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Uridine-15N2Uridine-15N2 is the 15N labeled Uridine[1]. |
| Name | Uridine-1,3-15N2 |
|---|---|
| Synonym | More Synonyms |
| Description | Uridine-15N2 is the 15N labeled Uridine[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C9H12N2O6 |
|---|---|
| Molecular Weight | 244.20100 |
| Exact Mass | 244.07000 |
| PSA | 124.78000 |
| InChIKey | DRTQHJPVMGBUCF-DMNIUWJGSA-N |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2O)c(=O)[nH]1 |
| Uridine-15N2 |