ethyl-dimethyl-tert-butyl-azanium structure
|
Common Name | ethyl-dimethyl-tert-butyl-azanium | ||
|---|---|---|---|---|
| CAS Number | 92384-93-5 | Molecular Weight | 257.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H20IN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-ethyl-dimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H20IN |
|---|---|
| Molecular Weight | 257.15600 |
| Exact Mass | 257.06400 |
| InChIKey | ABULBDOTACFPBV-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(C)C(C)(C)C.[I-] |
|
~%
ethyl-dimethyl-... CAS#:92384-93-5 |
| Literature: Cope et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 4720,4727 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Aethyl-tert-butyl-dimethyl-ammonium,Jodid |
| ethyl-tert-butyl-dimethyl-ammonium,iodide |
| t-butylethyldimethylammonium iodide |