N-(dimethyl-tert-butyl-silyl)oxybenzamide structure
|
Common Name | N-(dimethyl-tert-butyl-silyl)oxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 82475-72-7 | Molecular Weight | 251.39700 | |
| Density | 0.987g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H21NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[tert-butyl(dimethyl)silyl]oxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.987g/cm3 |
|---|---|
| Molecular Formula | C13H21NO2Si |
| Molecular Weight | 251.39700 |
| Exact Mass | 251.13400 |
| PSA | 38.33000 |
| LogP | 3.74410 |
| Index of Refraction | 1.489 |
| InChIKey | SGHFVSFJRLBGOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)ONC(=O)c1ccccc1 |
|
~70%
N-(dimethyl-ter... CAS#:82475-72-7 |
| Literature: Miller, Marvin J.; Zhao, Gaiying; Vakulenko, Sergei; Franzblau, Scott; Moellmann, Ute Organic and Biomolecular Chemistry, 2006 , vol. 4, # 22 p. 4178 - 4185 |
|
~9%
N-(dimethyl-ter... CAS#:82475-72-7 |
| Literature: Chiu; Chang; Ozkan; Zon; Fichter; Phillips Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 5 p. 542 - 551 |
| N-(DIMETHYL-TERT-BUTYL-SILYL)OXYBENZAMIDE |
| O-tert-butyldimethylsilyl benzhydroxamate |
| O-tert-butyldimethylsilyl-benzohydroxamic acid |