3-[(4-dimethylaminophenyl)methyl]oxolan-2-one
Modify Date: 2025-08-30 08:38:58
![3-[(4-dimethylaminophenyl)methyl]oxolan-2-one Structure](https://image.chemsrc.com/caspic/297/92040-91-0.png)
3-[(4-dimethylaminophenyl)methyl]oxolan-2-one structure
|
Common Name | 3-[(4-dimethylaminophenyl)methyl]oxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 92040-91-0 | Molecular Weight | 219.28000 | |
| Density | 1.138g/cm3 | Boiling Point | 392.2ºC at 760 mmHg | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | 3-[[4-(dimethylamino)phenyl]methyl]oxolan-2-one |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 392.2ºC at 760 mmHg |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28000 |
| Flash Point | 156.6ºC |
| Exact Mass | 219.12600 |
| PSA | 29.54000 |
| LogP | 1.85820 |
| Index of Refraction | 1.575 |
| InChIKey | RYZSMAUXHZCBGM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(CC2CCOC2=O)cc1 |
|
~%
3-[(4-dimethyla... CAS#:92040-91-0 |
| Literature: Zimmer; Rothe Journal of Organic Chemistry, 1959 , vol. 24, p. 28,30 |
|
~%
3-[(4-dimethyla... CAS#:92040-91-0 |
| Literature: Zimmer; Rothe Journal of Organic Chemistry, 1959 , vol. 24, p. 28,30 |
![(3E)-3-[(4-dimethylaminophenyl)methylidene]oxolan-2-one structure](https://image.chemsrc.com/caspic/398/58557-39-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |