N-(2,5-Dimethoxyphenyl)-3-hydroxy-2-naphthamide
Modify Date: 2025-09-18 13:45:48
N-(2,5-Dimethoxyphenyl)-3-hydroxy-2-naphthamide structure
|
Common Name | N-(2,5-Dimethoxyphenyl)-3-hydroxy-2-naphthamide | ||
|---|---|---|---|---|
| CAS Number | 92-73-9 | Molecular Weight | 323.34300 | |
| Density | 1.299g/cm3 | Boiling Point | 459.1ºC at 760 mmHg | |
| Molecular Formula | C19H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | N-(2,5-dimethoxyphenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760 mmHg |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.34300 |
| Flash Point | 231.4ºC |
| Exact Mass | 323.11600 |
| PSA | 67.79000 |
| LogP | 3.88790 |
| Index of Refraction | 1.678 |
| InChIKey | LAKNSQZHAUYJJM-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc3ccccc3cc2O)c1 |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
| Safety Phrases | S26-S37/39-S36/37/39 |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
N-(2,5-Dimethox... CAS#:92-73-9 |
| Literature: Journal of the Society of Dyers and Colourists, , vol. 46, p. 227,228 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Naphthol AS-BG Supra |
| Naphtazol BJ |
| Acna Naphthol BG |
| Solunaptol FOL |
| Cibanaphthol RDM |
| Naphtanilide BG |
| EINECS 202-183-4 |
| MFCD00043902 |
| 3-hydroxy-2',5'-dimethoxynaphthanilide |
| Brenthol FO |
| naphthol AS-BG |
| Sanatol BG |