1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-tetrakis(methylphosphonic acid) structure
|
Common Name | 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl-tetrakis(methylphosphonic acid) | ||
|---|---|---|---|---|
| CAS Number | 91987-74-5 | Molecular Weight | 548.297 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 921.6±75.0 °C at 760 mmHg | |
| Molecular Formula | C12H32N4O12P4 | Melting Point | 280ºC (DEC.) | |
| MSDS | N/A | Flash Point | 511.2±37.1 °C | |
| Name | ((1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetrayl)tetrakis(methylene))tetraphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 921.6±75.0 °C at 760 mmHg |
| Melting Point | 280ºC (DEC.) |
| Molecular Formula | C12H32N4O12P4 |
| Molecular Weight | 548.297 |
| Flash Point | 511.2±37.1 °C |
| Exact Mass | 548.096741 |
| PSA | 282.32000 |
| LogP | -8.24 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | RCXMQNIDOFXYDO-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)CN1CCN(CP(=O)(O)O)CCN(CP(=O)(O)O)CCN(CP(=O)(O)O)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phosphonic acid, [1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayltetrakis(methylene)]tetrakis- |
| [4,7,10-tris(phosphonomethyl)-1,4,7,10-tetrazacyclododec-1-yl]methylphosphonic acid |
| [1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetrayltetrakis(methylene)]tetrakis(phosphonic acid) |