2-amino-8-chloro-9-(2-hydroxyethoxymethyl)-3H-purin-6-one
Modify Date: 2025-10-02 09:47:33
2-amino-8-chloro-9-(2-hydroxyethoxymethyl)-3H-purin-6-one structure
|
Common Name | 2-amino-8-chloro-9-(2-hydroxyethoxymethyl)-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 91897-98-2 | Molecular Weight | 259.65000 | |
| Density | 1.9g/cm3 | Boiling Point | 592ºC at 760 mmHg | |
| Molecular Formula | C8H10ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.8ºC | |
| Name | 2-amino-8-chloro-9-(2-hydroxyethoxymethyl)-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9g/cm3 |
|---|---|
| Boiling Point | 592ºC at 760 mmHg |
| Molecular Formula | C8H10ClN5O3 |
| Molecular Weight | 259.65000 |
| Flash Point | 311.8ºC |
| Exact Mass | 259.04700 |
| PSA | 120.04000 |
| Index of Refraction | 1.775 |
| InChIKey | MYTTVFRFXXXOKZ-UHFFFAOYSA-N |
| SMILES | C(COCN1C2=C(C(=O)NC(=N2)N)N=C1Cl)O |
|
~50%
2-amino-8-chlor... CAS#:91897-98-2 |
| Literature: Robins, Morris J.; Hatfield, Peter W.; Balzarini, Jan; Clercq, Eric De Journal of Medicinal Chemistry, 1984 , vol. 27, # 11 p. 1486 - 1492 |
| 9-[(2-Hydroxyethoxy)methyl]-8-chloroguanine |