CAY10575 structure
|
Common Name | CAY10575 | ||
|---|---|---|---|---|
| CAS Number | 916985-21-2 | Molecular Weight | 487.549 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 735.4±70.0 °C at 760 mmHg | |
| Molecular Formula | C22H21N3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 398.5±35.7 °C | |
Use of CAY10575IKK2-IN-3 (Compound 8) is an IKK2 inhibitor with an IC50 of 0.075 μM[1]. |
| Name | 5-(5,6-dimethoxybenzimidazol-1-yl)-3-[(4-methylsulfonylphenyl)methoxy]thiophene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | IKK2-IN-3 (Compound 8) is an IKK2 inhibitor with an IC50 of 0.075 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
IKK2:0.075 μM (IC50) |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 735.4±70.0 °C at 760 mmHg |
| Molecular Formula | C22H21N3O6S2 |
| Molecular Weight | 487.549 |
| Flash Point | 398.5±35.7 °C |
| Exact Mass | 487.087189 |
| PSA | 159.36000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | YYZTVTZCYVZGRB-UHFFFAOYSA-N |
| SMILES | COc1cc2ncn(-c3cc(OCc4ccc(S(C)(=O)=O)cc4)c(C(N)=O)s3)c2cc1OC |
| 5-(5,6-Dimethoxy-1H-benzimidazol-1-yl)-3-{[4-(methylsulfonyl)benzyl]oxy}-2-thiophenecarboxamide |
| 2-Thiophenecarboxamide, 5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-[[4-(methylsulfonyl)phenyl]methoxy]- |
| HMS3229L15 |
| 5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-{[4-(methylsulfonyl)benzyl]oxy}thiophene-2-carboxamide |
| benzimidazole-thiophene carboxamide,2 |