3-(2-ethylbutanoylamino)benzoic acid
Modify Date: 2025-09-11 23:17:12
3-(2-ethylbutanoylamino)benzoic acid structure
|
Common Name | 3-(2-ethylbutanoylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 915923-97-6 | Molecular Weight | 235.27900 | |
| Density | 1.167g/cm3 | Boiling Point | 452.6ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.5ºC | |
| Name | 3-(2-ethylbutanoylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 452.6ºC at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 227.5ºC |
| Exact Mass | 235.12100 |
| PSA | 66.40000 |
| LogP | 2.83250 |
| Index of Refraction | 1.568 |
| InChIKey | UROVTCQGMDLCEE-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)Nc1cccc(C(=O)O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[(2-ethylbutanoyl)amino]benzoic acid |
| 3-(2-ethylbutanamido)benzoic acid |