3-(2-Phenylethoxy)benzoic acid
Modify Date: 2025-10-18 17:04:58
3-(2-Phenylethoxy)benzoic acid structure
|
Common Name | 3-(2-Phenylethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 123470-94-0 | Molecular Weight | 242.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 435.8±28.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.0±17.5 °C | |
| Name | 3-(2-phenylethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.8±28.0 °C at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 166.0±17.5 °C |
| Exact Mass | 242.094299 |
| PSA | 46.53000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | CBKMKWATRHJMKA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(OCCc2ccccc2)c1 |
| HS Code | 2918990090 |
|---|
|
~%
3-(2-Phenyletho... CAS#:123470-94-0 |
| Literature: Journal of the Chemical Society, , p. 430,432 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(phenethyloxy)benzoic acid |
| Benzoic acid, 3-(2-phenylethoxy)- |
| 3-(2-Phenylethoxy)benzoic acid |
| 3-Phenaethyloxy-benzoesaeure |
| 3-(2-Phenylethoxy)-benzoic acid |