N-(4-amino-6-benzylsulfanyl-pyrimidin-5-yl)formamide structure
|
Common Name | N-(4-amino-6-benzylsulfanyl-pyrimidin-5-yl)formamide | ||
|---|---|---|---|---|
| CAS Number | 91560-22-4 | Molecular Weight | 260.31500 | |
| Density | 1.36g/cm3 | Boiling Point | 536.2ºC at 760 mmHg | |
| Molecular Formula | C12H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.1ºC | |
| Name | N-(4-amino-6-benzylsulfanylpyrimidin-5-yl)formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 536.2ºC at 760 mmHg |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.31500 |
| Flash Point | 278.1ºC |
| Exact Mass | 260.07300 |
| PSA | 106.20000 |
| LogP | 3.20950 |
| Index of Refraction | 1.678 |
| InChIKey | DAIXRQOOBWXPLM-UHFFFAOYSA-N |
| SMILES | Nc1ncnc(SCc2ccccc2)c1NC=O |
|
~%
N-(4-amino-6-be... CAS#:91560-22-4 |
| Literature: Elion et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 2858,2862 |
|
~%
N-(4-amino-6-be... CAS#:91560-22-4 |
| Literature: Elion et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 2858,2862 |
| 6-benzylsulfanyl-5-formylamino-pyrimidin-4-ylamine |
| N-<4-Amino-6-benzylthio-5-pyrimidinyl>-formamide |
| N-<4-Amino-6-benzylthio-5-pyrimidinyl>-formamid |