LG 82-4-01
Modify Date: 2025-09-22 18:11:32
LG 82-4-01 structure
|
Common Name | LG 82-4-01 | ||
|---|---|---|---|---|
| CAS Number | 91505-19-0 | Molecular Weight | 309.16900 | |
| Density | N/A | Boiling Point | 540.6ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.8ºC | |
Use of LG 82-4-01LG 82-4-01 is a thromboxane (TX) synthetase specific inhibitor, with an IC50 of 1.3 μM[1]. |
| Name | 4-chloro-5-(2-imidazol-1-ylethoxy)thiophene-2-carboxylic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | LG 82-4-01 is a thromboxane (TX) synthetase specific inhibitor, with an IC50 of 1.3 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 540.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H10Cl2N2O3S |
| Molecular Weight | 309.16900 |
| Flash Point | 280.8ºC |
| Exact Mass | 307.97900 |
| PSA | 92.59000 |
| LogP | 3.17720 |
| InChIKey | GPQCCNMZXMIFRS-UHFFFAOYSA-N |
| SMILES | Cl.O=C(O)c1cc(Cl)c(OCCn2ccnc2)s1 |
| LG 82-4-01 |
| 4-chloro-5-[2-(1h-imidazol-1-yl)ethoxy]thiophene-2-carboxylic acid hydrochloride(1:1) |
| 5-(2-(1-Imidazolyl)ethoxy)-4-chlorothiophene-2-carboxylic acid |