Perfluorooctane structure
|
Common Name | Perfluorooctane | ||
|---|---|---|---|---|
| CAS Number | 307-34-6 | Molecular Weight | 438.057 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 102.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C8F18 | Melting Point | −25 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 30.7±10.2 °C | |
| Name | perfluorooctane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 102.5±0.0 °C at 760 mmHg |
| Melting Point | −25 °C(lit.) |
| Molecular Formula | C8F18 |
| Molecular Weight | 438.057 |
| Flash Point | 30.7±10.2 °C |
| Exact Mass | 437.971252 |
| LogP | 7.43 |
| Vapour Pressure | 38.8±0.1 mmHg at 25°C |
| Index of Refraction | 1.256 |
| InChIKey | YVBBRRALBYAZBM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Stability | Stable. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | F,Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | RG9701000 |
| HS Code | 2903399090 |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Interaction between perfluorcarbon liquid and heavy silicone oil: risk factor for "sticky oil" formation.
Curr. Eye Res. 37(7) , 563-6, (2012) To investigate in vitro the interaction between perfluorcarbon liquids (PFCLs) and heavy silicone oils (HSOs).Interactions between different kinds of PFCL [perfluoro-n-octane (PFO) or perfluorodecalin... |
|
|
Colored perfluorocarbon liquids as novel intraoperative tools.
Graefes Arch. Clin. Exp. Ophthalmol. 250(5) , 653-9, (2012) Perfluorocarbon liquids (PFCLs) are used as intraoperative tools to stabilize the retina during vitreoretinal surgeries. Their use would be much facilitated if PFCLs were colored and not transparent. ... |
|
|
Reversible and irreversible sorption of perfluorinated compounds (PFCs) by sediments of an urban reservoir.
Chemosphere 144 , 1747-53, (2015) Uncertainty about the extent to which contaminant sorption by suspended solids and bed sediments is irreversible is a major impediment for modeling and managing the water quality of surface water reso... |
| eftopef-l100 |
| Perfluorooctane |
| PERFLUORO-N-OCTANE |
| MFCD00042083 |
| Perfluoroctan |
| FC3280 |
| N-PERFLUORO OCTANE |
| FC-7118mc-6 |
| 4-01-00-00418 (Beilstein Handbook Reference) |
| Perfluoroctane |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluorooctane |
| Octane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-octadecafluoro- |
| Octadecafluorooctane |
| EINECS 206-199-2 |
| perfluoro-v-octane |
| perfluorinated octane |
| FluorinertPF5080 |
| PF5080 |