Ethyl 3-fluoro-4-nitrobenzoate structure
|
Common Name | Ethyl 3-fluoro-4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 914347-91-4 | Molecular Weight | 213.163 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 326.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H8FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.1±25.1 °C | |
| Name | ethyl 3-fluoro-4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.2±32.0 °C at 760 mmHg |
| Molecular Formula | C9H8FNO4 |
| Molecular Weight | 213.163 |
| Flash Point | 151.1±25.1 °C |
| Exact Mass | 213.043732 |
| PSA | 72.12000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | BFEJCZKSFRXXDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])c(F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Fluoro-4-nitrobenzoic acid ethyl ester |
| Ethyl 3-fluoro-4-nitrobenzoate |
| Benzoic acid, 3-fluoro-4-nitro-, ethyl ester |