6-Methoxy-1H-indole-3-carboxylic acid structure
|
Common Name | 6-Methoxy-1H-indole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 90924-43-9 | Molecular Weight | 191.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 447.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 224.5±23.2 °C | |
| Name | 6-Methoxy-1H-indole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.6±25.0 °C at 760 mmHg |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.183 |
| Flash Point | 224.5±23.2 °C |
| Exact Mass | 191.058243 |
| PSA | 62.32000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | LPBGVZVDBKMWFS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C(=O)O)c[nH]c2c1 |
| HS Code | 2933990090 |
|---|
|
~74%
6-Methoxy-1H-in... CAS#:90924-43-9 |
| Literature: PFIZER INC. Patent: WO2003/106462 A1, 2003 ; Location in patent: Page 55 ; |
|
~78%
6-Methoxy-1H-in... CAS#:90924-43-9 |
| Literature: Agouron Pharmaceuticals, Inc. Patent: US2004/9965 A1, 2004 ; |
|
~%
6-Methoxy-1H-in... CAS#:90924-43-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 6 p. 1849 - 1860 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-3-carboxylic acid, 6-methoxy- |
| 1h-indole-3-carboxylic acid,6-methoxy |
| 6-Methoxy-3-indolecarboxylicAcid |
| 6-Methoxy-1H-indole-3-carboxylicacid |
| 6-methoxyindole-3-carboxylic acid |
| 6-Methoxy-1H-indole-3-carboxylic acid |
| 6-Methoxyindol-3-carbonsaeure |
| MFCD05664010 |