Benzenesulfonamide,N,N-bis(2-chloroethyl)-4-nitro- structure
|
Common Name | Benzenesulfonamide,N,N-bis(2-chloroethyl)-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 90876-33-8 | Molecular Weight | 327.18400 | |
| Density | 1.469g/cm3 | Boiling Point | 473.4ºC at 760mmHg | |
| Molecular Formula | C10H12Cl2N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.1ºC | |
| Name | N,N-bis(2-chloroethyl)-4-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 473.4ºC at 760mmHg |
| Molecular Formula | C10H12Cl2N2O4S |
| Molecular Weight | 327.18400 |
| Flash Point | 240.1ºC |
| Exact Mass | 325.98900 |
| PSA | 91.58000 |
| LogP | 3.66710 |
| Index of Refraction | 1.576 |
| InChIKey | YKDCOJVGILKEFG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N(CCCl)CCCl)cc1 |
|
~%
Benzenesulfonam... CAS#:90876-33-8 |
| Literature: Ross; Wilson Journal of the Chemical Society, 1959 , p. 3616,3618 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-benzolsulfonsaeure-bis-<2-chlor-aethyl>-amid |