Benzenesulfonamide,N,N-bis(2-chloroethyl)-4-methoxy-
Modify Date: 2025-08-27 12:41:43
Benzenesulfonamide,N,N-bis(2-chloroethyl)-4-methoxy- structure
|
Common Name | Benzenesulfonamide,N,N-bis(2-chloroethyl)-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 86357-59-7 | Molecular Weight | 312.21300 | |
| Density | 1.329g/cm3 | Boiling Point | 431.8ºC at 760mmHg | |
| Molecular Formula | C11H15Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | 4-methoxy-benzenesulfonic acid-[bis-(2-chloro-ethyl)-amide] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760mmHg |
| Molecular Formula | C11H15Cl2NO3S |
| Molecular Weight | 312.21300 |
| Flash Point | 214.9ºC |
| Exact Mass | 311.01500 |
| PSA | 54.99000 |
| LogP | 3.24430 |
| Index of Refraction | 1.543 |
| InChIKey | HUVWULNCGBXDRQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N(CCCl)CCCl)cc1 |
|
~%
Benzenesulfonam... CAS#:86357-59-7 |
| Literature: Ross; Wilson Journal of the Chemical Society, 1959 , p. 3616,3618 |
![3-BROMO-6,7-DIHYDRO-5H-PYRROLO[3,4-B]PYRIDINE structure](https://image.chemsrc.com/caspic/189/334-22-5.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Methoxy-benzolsulfonsaeure-(methyl-nitroso-amid) |
| 1,1-bis(methylsulfonyl)cyclopropane |
| 4-methoxy-benzenesulfonic acid-(methyl-nitroso-amide) |
| Benzenesulfonamide,4-methoxy-N-methyl-N-nitroso |
| BENZENESULFONAMIDE,N,N-BIS(2-CHLOROETHYL)-4-METHOXY- |
| N,N-bis(2-chloroethyl)-4-methoxybenzenesulfonamide |
| 4-Methoxy-benzolsulfonsaeure-[bis-(2-chlor-aethyl)-amid] |
| N,N-dichloroethyl-4-methoxybenzenesulfonamide |