AKOS JY2082718
Modify Date: 2025-09-11 22:11:20
AKOS JY2082718 structure
|
Common Name | AKOS JY2082718 | ||
|---|---|---|---|---|
| CAS Number | 90766-47-5 | Molecular Weight | 254.08000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Bromo-1-methyl-1H-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8BrNO2 |
|---|---|
| Molecular Weight | 254.08000 |
| Exact Mass | 252.97400 |
| PSA | 42.23000 |
| LogP | 2.63900 |
| InChIKey | GCGFIFNQFLLJIR-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)cc2cc(Br)ccc21 |
| HS Code | 2933990090 |
|---|
|
~%
AKOS JY2082718 CAS#:90766-47-5 |
| Literature: Hulme, Christopher; Ncube, Mghele Vellah; Norman, Mark H.; Ognyanov, Vassil I.; Pettus, Liping H.; Wang, Xianghong; Zhu, Jiawang Patent: US2005/165049 A1, 2005 ; Location in patent: Page/Page column 14 ; US 20050165049 A1 |
|
~%
AKOS JY2082718 CAS#:90766-47-5 |
| Literature: Sokolovs, Igors; Lubriks, Dmitrijs; Suna, Edgars Journal of the American Chemical Society, 2014 , vol. 136, # 19 p. 6920 - 6928 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-5-bromo-4-nitro-1H-imidazole |
| 1-Methyl-5-bromo-4-nitroimidazole |
| 5-BROMO-1-METHYL-4-NITRO-1H-IMIDAZOLE |
| 5-bromo-1-methyl-2-indolecarboxylic acid |
| 5-bromo-1-methyl-indole-2-carboxylic acid |
| Mtr 1-80 |
| 5-Brom-1-methyl-4-nitro-1H-imidazol |