1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium
Modify Date: 2025-08-26 18:46:35
1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium structure
|
Common Name | 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium | ||
|---|---|---|---|---|
| CAS Number | 90693-88-2 | Molecular Weight | 811.03300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H77NNaO10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium is a ubstitute for Phosphoserine/phosphatidylserine. 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium can be used in lipid mixtures with DOPC and DOPE as effective nontoxic and nonviral DNA vectors[1]. |
| Name | 4,6,10-Trioxa-5-phosphaoctacos-19-enoic acid, 2-amino-5-hydroxy-11-oxo-8-[[(9Z)-1-oxo-9-octadecenyl]oxy]-, 5-oxide, sodium salt (1:1), (2S,8R,19Z) |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium is a ubstitute for Phosphoserine/phosphatidylserine. 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium can be used in lipid mixtures with DOPC and DOPE as effective nontoxic and nonviral DNA vectors[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H77NNaO10P |
|---|---|
| Molecular Weight | 811.03300 |
| Exact Mass | 810.52600 |
| PSA | 181.49000 |
| LogP | 11.76220 |
| InChIKey | BFELZCFBGSWOJS-YORIBCANSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC=CCCCCCCCC.[Na] |
| Storage condition | -20°C |
| L-Serine, (2R)-2,3-bis[[(9Z)-1-oxo-9-octadecenyl]oxy]propyl hydrogen phosphate (ester), monosodium salt |
| L-Serine, 2,3-bis[(1-oxo-9-octadecenyl)oxy]propyl hydrogen phosphate (ester), monosodium salt, [R-(Z,Z)]- |
| Coatsome MS 8181LS |