Benzyl-piperazine-CO-benzothiazole-4-methylpiperidine structure
|
Common Name | Benzyl-piperazine-CO-benzothiazole-4-methylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 906258-48-8 | Molecular Weight | 434.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Benzyl-piperazine-CO-benzothiazole-4-methylpiperidineBenzyl-piperazine-CO-benzothiazole-4-methylpiperidine alters the lifespan of a eukaryotic organism[1]. |
| Name | (4-Benzylpiperazin-1-yl)(2-(4-methylpiperidin-1-yl)benzo[d]thiazol-6-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-piperazine-CO-benzothiazole-4-methylpiperidine alters the lifespan of a eukaryotic organism[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H30N4OS |
|---|---|
| Molecular Weight | 434.6 |
| InChIKey | HGNATFYYPPTOPR-UHFFFAOYSA-N |
| SMILES | CC1CCN(c2nc3ccc(C(=O)N4CCN(Cc5ccccc5)CC4)cc3s2)CC1 |
| MFCD14801450 |