N-[(4-methylphenyl)methyl]-3-nitro-aniline structure
|
Common Name | N-[(4-methylphenyl)methyl]-3-nitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 90465-61-5 | Molecular Weight | 242.27300 | |
| Density | 1.225g/cm3 | Boiling Point | 393.7ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | N-[(4-methylphenyl)methyl]-3-nitroaniline |
|---|
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 393.7ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 191.9ºC |
| Exact Mass | 242.10600 |
| PSA | 57.85000 |
| LogP | 4.11150 |
| Index of Refraction | 1.645 |
| InChIKey | ANVKUDDLGAYXIW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CNc2cccc([N+](=O)[O-])c2)cc1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |