N-(4-methylphenyl)-3-nitro-benzamide
Modify Date: 2025-09-24 18:54:30
N-(4-methylphenyl)-3-nitro-benzamide structure
|
Common Name | N-(4-methylphenyl)-3-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 6911-92-8 | Molecular Weight | 256.25700 | |
| Density | 1.304g/cm3 | Boiling Point | 340.1ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | 3-(4-methylcyclohex-3-en-1-yl)but-3-enyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 340.1ºC at 760 mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 159.5ºC |
| Exact Mass | 256.08500 |
| PSA | 74.92000 |
| LogP | 3.75170 |
| Index of Refraction | 1.656 |
| InChIKey | UEPGMSOIQCDFBZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| HS Code | 2924299090 |
|---|
|
~84%
N-(4-methylphen... CAS#:6911-92-8 |
| Literature: Al-Nadaf, Afaf; Sheikha, Ghassan Abu; Taha, Mutasem O. Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 9 p. 3088 - 3115 |
|
~77%
N-(4-methylphen... CAS#:6911-92-8 |
| Literature: Gao, Jie; Wang, Guan-Wu Journal of Organic Chemistry, 2008 , vol. 73, # 7 p. 2955 - 2958 |
|
~90%
N-(4-methylphen... CAS#:6911-92-8 |
| Literature: Toa Eiyo, Ltd. Patent: US5728835 A1, 1998 ; |
|
~%
N-(4-methylphen... CAS#:6911-92-8 |
| Literature: Zhang, Xuan; Liu, Chun-Hua; Liu, Li-Hong; Wu, Fang-Ying; Guo, Lin; Sun, Xiang-Ying; Wang, Chao-Jie; Jiang, Yun-Bao Organic and Biomolecular Chemistry, 2003 , vol. 1, # 4 p. 728 - 732 |
CAS#:14315-26-5
CAS#:6393-42-6| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-nitro-benzoic acid propylamide |
| 3-Nitro-N-propyl-benzamide |
| 3-nitro-N-p-tolyl-benzamide |
| m-nitrobenzoylpropylamide |
| 3-Nitro-benzoesaeure-p-toluidid |
| 3-nitro-benzoic acid p-toluidide |
| 3-Nitro-benzoesaeure-propylamid |
| N-n-propyl 3-nitrobenzamide |