NR2F6 modulator-1 structure
|
Common Name | NR2F6 modulator-1 | ||
|---|---|---|---|---|
| CAS Number | 904449-84-9 | Molecular Weight | 419.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NR2F6 modulator-1NR2F6 modulator-1 is a potent nuclear receptor subfamily 2, group F, member 6 (NR2F6) modulator. NR2F6 modulator-1 can be used for researching immune modulation and modulation of cancer stem cell activity[1]. |
| Name | NR2F6 modulator-1 |
|---|
| Description | NR2F6 modulator-1 is a potent nuclear receptor subfamily 2, group F, member 6 (NR2F6) modulator. NR2F6 modulator-1 can be used for researching immune modulation and modulation of cancer stem cell activity[1]. |
|---|---|
| Related Catalog | |
| Target |
NR2F6[1] |
| References |
| Molecular Formula | C23H17NO5S |
|---|---|
| Molecular Weight | 419.45 |
| InChIKey | ZNYVQFURPOKGQG-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)c1ccc2oc(=O)c(S(=O)(=O)c3ccccc3)cc2c1 |