3-ethylcyclopropane-1,1,2,2-tetracarbonitrile
Modify Date: 2025-08-30 18:31:54
3-ethylcyclopropane-1,1,2,2-tetracarbonitrile structure
|
Common Name | 3-ethylcyclopropane-1,1,2,2-tetracarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 90418-91-0 | Molecular Weight | 170.17100 | |
| Density | 1.25g/cm3 | Boiling Point | 493ºC at 760 mmHg | |
| Molecular Formula | C9H6N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.4ºC | |
| Name | 3-ethylcyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 493ºC at 760 mmHg |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.17100 |
| Flash Point | 264.4ºC |
| Exact Mass | 170.05900 |
| PSA | 95.16000 |
| LogP | 1.09332 |
| Index of Refraction | 1.523 |
| InChIKey | IHMVHEVGDWLAFF-UHFFFAOYSA-N |
| SMILES | CCC1C(C#N)(C#N)C1(C#N)C#N |
|
~89%
3-ethylcyclopro... CAS#:90418-91-0 |
| Literature: Araki, Shuki; Butsugan, Yasuo Journal of the Chemical Society, Chemical Communications, 1989 , # 17 p. 1286 - 1287 |
|
~%
3-ethylcyclopro... CAS#:90418-91-0 |
| Literature: Mariella; Roth Journal of Organic Chemistry, 1957 , vol. 22, p. 1130 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Aethyl-1,1,2,2-tetracyan-cyclopropan |
| 3-ethyl-cyclopropane-1,1,2,2-tetracarbonitrile |
| 3-Aethyl-cyclopropan-1,1,2,2-tetracarbonitril |
| 3-ethyl-1,1,2,2-tetracyanopropane |